C23H24N6O5 — CID 22533821
2-methylpropyl 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533821) has the molecular formula C23H24N6O5 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-methylpropyl 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533821 |
| Molecular Formula | C23H24N6O5 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-methylpropyl 4-[[6-[2-(2-methylbenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(Nc2ccc(C(=O)OCC(C)C)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N6O5/c1-14(2)12-34-23(31)16-8-10-17(11-9-16)26-20-19(29(32)33)21(25-13-24-20)27-28-22(30)18-7-5-4-6-15(18)3/h4-11,13-14H,12H2,1-3H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | WJZSNMAZOLEUHV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|