C21H20FN5O4 — CID 22533278
2-methylpropyl 4-[[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533278) has the molecular formula C21H20FN5O4 and a molecular weight of 425.42 g/mol. Its IUPAC name is 2-methylpropyl 4-[[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533278 |
| Molecular Formula | C21H20FN5O4 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-methylpropyl 4-[[6-(4-fluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(Nc3ccc(F)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H20FN5O4/c1-13(2)11-31-21(28)14-3-7-16(8-4-14)25-19-18(27(29)30)20(24-12-23-19)26-17-9-5-15(22)6-10-17/h3-10,12-13H,11H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | MGQZJFGHLAKJIJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|