C21H19F2N5O4 — CID 22533876
2-methylpropyl 4-[[6-(2,5-difluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533876) has the molecular formula C21H19F2N5O4 and a molecular weight of 443.41 g/mol. Its IUPAC name is 2-methylpropyl 4-[[6-(2,5-difluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[6-(2,5-difluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533876 |
| Molecular Formula | C21H19F2N5O4 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-methylpropyl 4-[[6-(2,5-difluoroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(Nc3cc(F)ccc3F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19F2N5O4/c1-12(2)10-32-21(29)13-3-6-15(7-4-13)26-19-18(28(30)31)20(25-11-24-19)27-17-9-14(22)5-8-16(17)23/h3-9,11-12H,10H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | KZOMACHNOCZMQC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|