C15H15ClN4O4 — CID 23477346
2-methylpropyl 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]benzoate (PubChem CID 23477346) has the molecular formula C15H15ClN4O4 and a molecular weight of 350.76 g/mol. Its IUPAC name is 2-methylpropyl 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]benzoate.
| Compound Name | 2-methylpropyl 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 23477346 |
| Molecular Formula | C15H15ClN4O4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-methylpropyl 4-[(6-chloro-5-nitropyrimidin-4-yl)amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15ClN4O4/c1-9(2)7-24-15(21)10-3-5-11(6-4-10)19-14-12(20(22)23)13(16)17-8-18-14/h3-6,8-9H,7H2,1-2H3,(H,17,18,19) |
| InChIKey | LUGDZSGJZDJPDO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|