C17H20N4O5 — CID 22533847
2-methylpropyl 4-[(6-ethoxy-5-nitropyrimidin-4-yl)amino]benzoate (PubChem CID 22533847) has the molecular formula C17H20N4O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-methylpropyl 4-[(6-ethoxy-5-nitropyrimidin-4-yl)amino]benzoate.
| Compound Name | 2-methylpropyl 4-[(6-ethoxy-5-nitropyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 22533847 |
| Molecular Formula | C17H20N4O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-methylpropyl 4-[(6-ethoxy-5-nitropyrimidin-4-yl)amino]benzoate |
| SMILES | CCOc1ncnc(Nc2ccc(C(=O)OCC(C)C)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O5/c1-4-25-16-14(21(23)24)15(18-10-19-16)20-13-7-5-12(6-8-13)17(22)26-9-11(2)3/h5-8,10-11H,4,9H2,1-3H3,(H,18,19,20) |
| InChIKey | UTOABPCKZZWAFM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|