C26H29N5O6 — CID 22533806
2-methylpropyl 4-[[6-[4-(2-methylpropoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533806) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is 2-methylpropyl 4-[[6-[4-(2-methylpropoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | 2-methylpropyl 4-[[6-[4-(2-methylpropoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533806 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-methylpropyl 4-[[6-[4-(2-methylpropoxycarbonyl)anilino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(Nc3ccc(C(=O)OCC(C)C)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H29N5O6/c1-16(2)13-36-25(32)18-5-9-20(10-6-18)29-23-22(31(34)35)24(28-15-27-23)30-21-11-7-19(8-12-21)26(33)37-14-17(3)4/h5-12,15-17H,13-14H2,1-4H3,(H2,27,28,29,30) |
| InChIKey | JIMCSIDJBUNKJR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|