C15H16N4O5 — CID 135585660
2-methylpropyl 4-[(5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]benzoate (PubChem CID 135585660) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-methylpropyl 4-[(5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]benzoate.
| Compound Name | 2-methylpropyl 4-[(5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 135585660 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-methylpropyl 4-[(5-nitro-6-oxo-1H-pyrimidin-4-yl)amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2nc[nH]c(=O)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H16N4O5/c1-9(2)7-24-15(21)10-3-5-11(6-4-10)18-13-12(19(22)23)14(20)17-8-16-13/h3-6,8-9H,7H2,1-2H3,(H2,16,17,18,20) |
| InChIKey | SEFDQYYGDVNFNE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|