C18H22N4O5 — CID 22533848
2-methylpropyl 4-[(5-nitro-6-propan-2-yloxypyrimidin-4-yl)amino]benzoate (PubChem CID 22533848) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-methylpropyl 4-[(5-nitro-6-propan-2-yloxypyrimidin-4-yl)amino]benzoate.
| Compound Name | 2-methylpropyl 4-[(5-nitro-6-propan-2-yloxypyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 22533848 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-methylpropyl 4-[(5-nitro-6-propan-2-yloxypyrimidin-4-yl)amino]benzoate |
| SMILES | CC(C)COC(=O)c1ccc(Nc2ncnc(OC(C)C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H22N4O5/c1-11(2)9-26-18(23)13-5-7-14(8-6-13)21-16-15(22(24)25)17(20-10-19-16)27-12(3)4/h5-8,10-12H,9H2,1-4H3,(H,19,20,21) |
| InChIKey | AVZLVTCGFCMTJR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|