C19H16N8O6 — CID 22535258
2-methyl-N'-[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide (PubChem CID 22535258) has the molecular formula C19H16N8O6 and a molecular weight of 452.39 g/mol. Its IUPAC name is 2-methyl-N'-[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methyl-N'-[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535258 |
| Molecular Formula | C19H16N8O6 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | 2-methyl-N'-[5-nitro-6-[2-(2-nitrobenzoyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NNC(=O)c2ccccc2[N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N8O6/c1-11-6-2-3-7-12(11)18(28)24-22-16-15(27(32)33)17(21-10-20-16)23-25-19(29)13-8-4-5-9-14(13)26(30)31/h2-10H,1H3,(H,24,28)(H,25,29)(H2,20,21,22,23) |
| InChIKey | ZHEYBCOJQPCXGK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|