C18H12N8O5S — CID 22528538
N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide (PubChem CID 22528538) has the molecular formula C18H12N8O5S and a molecular weight of 452.41 g/mol. Its IUPAC name is N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide.
| Compound Name | N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22528538 |
| Molecular Formula | C18H12N8O5S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-2-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2nc3ccccc3s2)c1[N+](=O)[O-])c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H12N8O5S/c27-17(10-5-1-3-7-12(10)25(28)29)24-23-16-14(26(30)31)15(19-9-20-16)22-18-21-11-6-2-4-8-13(11)32-18/h1-9H,(H,24,27)(H2,19,20,21,22,23) |
| InChIKey | SJEOURXGUWHTFB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|