C15H16N6O2S — CID 23486728
4-N-(1,3-benzothiazol-2-yl)-6-N-butyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23486728) has the molecular formula C15H16N6O2S and a molecular weight of 344.40 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-N-butyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-butyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23486728 |
| Molecular Formula | C15H16N6O2S |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-N-butyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCNc1ncnc(Nc2nc3ccccc3s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16N6O2S/c1-2-3-8-16-13-12(21(22)23)14(18-9-17-13)20-15-19-10-6-4-5-7-11(10)24-15/h4-7,9H,2-3,8H2,1H3,(H2,16,17,18,19,20) |
| InChIKey | AXZYTMSWHJZIJO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|