C16H18N6O3S — CID 22526524
6-N-(3-methoxypropyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22526524) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 6-N-(3-methoxypropyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-methoxypropyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526524 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 6-N-(3-methoxypropyl)-4-N-(4-methyl-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COCCCNc1ncnc(Nc2nc3c(C)cccc3s2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N6O3S/c1-10-5-3-6-11-12(10)20-16(26-11)21-15-13(22(23)24)14(18-9-19-15)17-7-4-8-25-2/h3,5-6,9H,4,7-8H2,1-2H3,(H2,17,18,19,20,21) |
| InChIKey | UVLXUBOTHVNJMO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|