C18H14N8O3S — CID 22534342
N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22534342) has the molecular formula C18H14N8O3S and a molecular weight of 422.43 g/mol. Its IUPAC name is N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22534342 |
| Molecular Formula | C18H14N8O3S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N'-[6-[(4-methyl-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | Cc1cccc2sc(Nc3ncnc(NNC(=O)c4cccnc4)c3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C18H14N8O3S/c1-10-4-2-6-12-13(10)22-18(30-12)23-15-14(26(28)29)16(21-9-20-15)24-25-17(27)11-5-3-7-19-8-11/h2-9H,1H3,(H,25,27)(H2,20,21,22,23,24) |
| InChIKey | GSIOXTSASIIDEZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|