C19H14N8O3 — CID 22536631
N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22536631) has the molecular formula C19H14N8O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22536631 |
| Molecular Formula | C19H14N8O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cccc3ncccc23)c1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C19H14N8O3/c28-19(12-4-2-8-20-10-12)26-25-18-16(27(29)30)17(22-11-23-18)24-15-7-1-6-14-13(15)5-3-9-21-14/h1-11H,(H,26,28)(H2,22,23,24,25) |
| InChIKey | SBZMXZZTZJYUNG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 147.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|