C21H17N7O4 — CID 22536109
2-methoxy-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22536109) has the molecular formula C21H17N7O4 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-methoxy-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methoxy-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22536109 |
| Molecular Formula | C21H17N7O4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-methoxy-N'-[5-nitro-6-(quinolin-5-ylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(Nc2cccc3ncccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N7O4/c1-32-17-10-3-2-6-14(17)21(29)27-26-20-18(28(30)31)19(23-12-24-20)25-16-9-4-8-15-13(16)7-5-11-22-15/h2-12H,1H3,(H,27,29)(H2,23,24,25,26) |
| InChIKey | GCGWAENXKANJHP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 144.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|