C12H13N7O4 — CID 22534718
N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methoxybenzohydrazide (PubChem CID 22534718) has the molecular formula C12H13N7O4 and a molecular weight of 319.28 g/mol. Its IUPAC name is N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methoxybenzohydrazide.
| Compound Name | N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methoxybenzohydrazide |
|---|---|
| PubChem CID | 22534718 |
| Molecular Formula | C12H13N7O4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)-2-methoxybenzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N7O4/c1-23-8-5-3-2-4-7(8)12(20)18-17-11-9(19(21)22)10(16-13)14-6-15-11/h2-6H,13H2,1H3,(H,18,20)(H2,14,15,16,17) |
| InChIKey | YPCUMGMDLNNJGM-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|