C20H20N6O4 — CID 22534624
2-methoxy-N'-[6-[(4-methylphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22534624) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-methoxy-N'-[6-[(4-methylphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methoxy-N'-[6-[(4-methylphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22534624 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 2-methoxy-N'-[6-[(4-methylphenyl)methylamino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(NCc2ccc(C)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O4/c1-13-7-9-14(10-8-13)11-21-18-17(26(28)29)19(23-12-22-18)24-25-20(27)15-5-3-4-6-16(15)30-2/h3-10,12H,11H2,1-2H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | VRJKBLARMCOUBV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|