C20H19N7O5 — CID 22536099
2-methoxy-N'-[5-nitro-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide (PubChem CID 22536099) has the molecular formula C20H19N7O5 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-methoxy-N'-[5-nitro-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methoxy-N'-[5-nitro-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22536099 |
| Molecular Formula | C20H19N7O5 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-methoxy-N'-[5-nitro-6-[2-(2-phenylacetyl)hydrazinyl]pyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(NNC(=O)Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N7O5/c1-32-15-10-6-5-9-14(15)20(29)26-25-19-17(27(30)31)18(21-12-22-19)24-23-16(28)11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H,23,28)(H,26,29)(H2,21,22,24,25) |
| InChIKey | PICCHVRVSFHOTE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|