C20H18N8O6 — CID 22535274
2-methyl-N'-[5-nitro-6-[2-[2-(4-nitrophenyl)acetyl]hydrazinyl]pyrimidin-4-yl]benzohydrazide (PubChem CID 22535274) has the molecular formula C20H18N8O6 and a molecular weight of 466.41 g/mol. Its IUPAC name is 2-methyl-N'-[5-nitro-6-[2-[2-(4-nitrophenyl)acetyl]hydrazinyl]pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methyl-N'-[5-nitro-6-[2-[2-(4-nitrophenyl)acetyl]hydrazinyl]pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535274 |
| Molecular Formula | C20H18N8O6 |
| Molecular Weight | 466.41 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 2-methyl-N'-[5-nitro-6-[2-[2-(4-nitrophenyl)acetyl]hydrazinyl]pyrimidin-4-yl]benzohydrazide |
| SMILES | Cc1ccccc1C(=O)NNc1ncnc(NNC(=O)Cc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N8O6/c1-12-4-2-3-5-15(12)20(30)26-25-19-17(28(33)34)18(21-11-22-19)24-23-16(29)10-13-6-8-14(9-7-13)27(31)32/h2-9,11H,10H2,1H3,(H,23,29)(H,26,30)(H2,21,22,24,25) |
| InChIKey | PQGHSFWSURONLJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|