C20H20N6O3 — CID 23495322
N'-[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 23495322) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is N'-[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 23495322 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N'-[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | Cc1cccc(Nc2ncnc(NNC(=O)Cc3ccccc3)c2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C20H20N6O3/c1-13-7-6-10-16(14(13)2)23-19-18(26(28)29)20(22-12-21-19)25-24-17(27)11-15-8-4-3-5-9-15/h3-10,12H,11H2,1-2H3,(H,24,27)(H2,21,22,23,25) |
| InChIKey | CDLBVUABIRVILY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|