C20H19N5O4 — CID 23495253
methyl 2-[[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23495253) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is methyl 2-[[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23495253 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | methyl 2-[[6-(2,3-dimethylanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(Nc2cccc(C)c2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N5O4/c1-12-7-6-10-15(13(12)2)23-18-17(25(27)28)19(22-11-21-18)24-16-9-5-4-8-14(16)20(26)29-3/h4-11H,1-3H3,(H2,21,22,23,24) |
| InChIKey | APFRALYUOGWRGP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|