C22H17N5O4 — CID 22527508
methyl 2-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22527508) has the molecular formula C22H17N5O4 and a molecular weight of 415.41 g/mol. Its IUPAC name is methyl 2-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22527508 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | methyl 2-[[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(Nc2cccc3ccccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N5O4/c1-31-22(28)16-10-4-5-11-18(16)26-21-19(27(29)30)20(23-13-24-21)25-17-12-6-8-14-7-2-3-9-15(14)17/h2-13H,1H3,(H2,23,24,25,26) |
| InChIKey | JCHQDNAJYVWWQR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|