C18H21N5O4 — CID 23487728
methyl 2-[[6-(cyclohexylamino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23487728) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is methyl 2-[[6-(cyclohexylamino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 2-[[6-(cyclohexylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23487728 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | methyl 2-[[6-(cyclohexylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(NC2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H21N5O4/c1-27-18(24)13-9-5-6-10-14(13)22-17-15(23(25)26)16(19-11-20-17)21-12-7-3-2-4-8-12/h5-6,9-12H,2-4,7-8H2,1H3,(H2,19,20,21,22) |
| InChIKey | HLQXEFNWBMOAFP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|