C19H22N6O6 — CID 22528874
ethyl 4-[6-(2-methoxycarbonylanilino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 22528874) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is ethyl 4-[6-(2-methoxycarbonylanilino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(2-methoxycarbonylanilino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22528874 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl 4-[6-(2-methoxycarbonylanilino)-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3ccccc3C(=O)OC)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H22N6O6/c1-3-31-19(27)24-10-8-23(9-11-24)17-15(25(28)29)16(20-12-21-17)22-14-7-5-4-6-13(14)18(26)30-2/h4-7,12H,3,8-11H2,1-2H3,(H,20,21,22) |
| InChIKey | QYRSZXPANVOFAY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 140.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|