C17H21N7O4 — CID 22527192
ethyl 4-[6-[(3-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 22527192) has the molecular formula C17H21N7O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is ethyl 4-[6-[(3-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(3-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22527192 |
| Molecular Formula | C17H21N7O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | ethyl 4-[6-[(3-methyl-2-pyridinyl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3ncccc3C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H21N7O4/c1-3-28-17(25)23-9-7-22(8-10-23)16-13(24(26)27)15(19-11-20-16)21-14-12(2)5-4-6-18-14/h4-6,11H,3,7-10H2,1-2H3,(H,18,19,20,21) |
| InChIKey | WFASEIYQRIYXRU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|