C15H19N7O5 — CID 23479079
ethyl 4-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 23479079) has the molecular formula C15H19N7O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is ethyl 4-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23479079 |
| Molecular Formula | C15H19N7O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | ethyl 4-[6-[(5-methyl-1,2-oxazol-3-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3cc(C)on3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H19N7O5/c1-3-26-15(23)21-6-4-20(5-7-21)14-12(22(24)25)13(16-9-17-14)18-11-8-10(2)27-19-11/h8-9H,3-7H2,1-2H3,(H,16,17,18,19) |
| InChIKey | CGUFUUYHNUODDI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 139.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|