C19H21N7O5S — CID 22535237
ethyl 4-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 22535237) has the molecular formula C19H21N7O5S and a molecular weight of 459.49 g/mol. Its IUPAC name is ethyl 4-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 22535237 |
| Molecular Formula | C19H21N7O5S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | ethyl 4-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2ncnc(Nc3nc4ccc(OC)cc4s3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H21N7O5S/c1-3-31-19(27)25-8-6-24(7-9-25)17-15(26(28)29)16(20-11-21-17)23-18-22-13-5-4-12(30-2)10-14(13)32-18/h4-5,10-11H,3,6-9H2,1-2H3,(H,20,21,22,23) |
| InChIKey | YWMAJIYFKXVCRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|