C19H23N7O3S — CID 22526078
4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 22526078) has the molecular formula C19H23N7O3S and a molecular weight of 429.51 g/mol. Its IUPAC name is 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22526078 |
| Molecular Formula | C19H23N7O3S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(2-piperidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3ncnc(NCCN4CCCCC4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H23N7O3S/c1-29-13-5-6-14-15(11-13)30-19(23-14)24-18-16(26(27)28)17(21-12-22-18)20-7-10-25-8-3-2-4-9-25/h5-6,11-12H,2-4,7-10H2,1H3,(H2,20,21,22,23,24) |
| InChIKey | MJKHYBQWHRSRBK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|