C20H16N6O5S — CID 22533716
methyl 4-[[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533716) has the molecular formula C20H16N6O5S and a molecular weight of 452.45 g/mol. Its IUPAC name is methyl 4-[[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533716 |
| Molecular Formula | C20H16N6O5S |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | methyl 4-[[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(Nc3nc4ccc(OC)cc4s3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H16N6O5S/c1-30-13-7-8-14-15(9-13)32-20(24-14)25-18-16(26(28)29)17(21-10-22-18)23-12-5-3-11(4-6-12)19(27)31-2/h3-10H,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | KGONTXZOTDDVDI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|