C18H13ClN6O3S — CID 22532048
6-N-(2-chlorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22532048) has the molecular formula C18H13ClN6O3S and a molecular weight of 428.86 g/mol. Its IUPAC name is 6-N-(2-chlorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-chlorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22532048 |
| Molecular Formula | C18H13ClN6O3S |
| Molecular Weight | 428.86 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 6-N-(2-chlorophenyl)-4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3ncnc(Nc4ccccc4Cl)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C18H13ClN6O3S/c1-28-10-6-7-13-14(8-10)29-18(23-13)24-17-15(25(26)27)16(20-9-21-17)22-12-5-3-2-4-11(12)19/h2-9H,1H3,(H2,20,21,22,23,24) |
| InChIKey | GPCZAPZHCMKIKQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|