C24H18N8O3S — CID 22529067
4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine (PubChem CID 22529067) has the molecular formula C24H18N8O3S and a molecular weight of 498.53 g/mol. Its IUPAC name is 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22529067 |
| Molecular Formula | C24H18N8O3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 4-N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitro-6-N-(4-phenyldiazenylphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc2nc(Nc3ncnc(Nc4ccc(/N=N/c5ccccc5)cc4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C24H18N8O3S/c1-35-18-11-12-19-20(13-18)36-24(28-19)29-23-21(32(33)34)22(25-14-26-23)27-15-7-9-17(10-8-15)31-30-16-5-3-2-4-6-16/h2-14H,1H3,(H2,25,26,27,28,29)/b31-30+ |
| InChIKey | JZSGPPBCWNTWBR-NVQSTNCTSA-N |
| XLogP | 6.91 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|