C19H14N8O6S — CID 22535170
N'-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide (PubChem CID 22535170) has the molecular formula C19H14N8O6S and a molecular weight of 482.44 g/mol. Its IUPAC name is N'-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide.
| Compound Name | N'-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22535170 |
| Molecular Formula | C19H14N8O6S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N'-[6-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
| SMILES | COc1ccc2nc(Nc3ncnc(NNC(=O)c4ccc([N+](=O)[O-])cc4)c3[N+](=O)[O-])sc2c1 |
| InChI | InChI=1S/C19H14N8O6S/c1-33-12-6-7-13-14(8-12)34-19(22-13)23-16-15(27(31)32)17(21-9-20-16)24-25-18(28)10-2-4-11(5-3-10)26(29)30/h2-9H,1H3,(H,25,28)(H2,20,21,22,23,24) |
| InChIKey | ZTWDUPNYCDWGMY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 187.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|