C19H16N8O7 — CID 22536013
N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536013) has the molecular formula C19H16N8O7 and a molecular weight of 468.39 g/mol. Its IUPAC name is N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536013 |
| Molecular Formula | C19H16N8O7 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(NNC(=O)c3cccc([N+](=O)[O-])c3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16N8O7/c1-34-14-7-5-11(6-8-14)18(28)24-22-16-15(27(32)33)17(21-10-20-16)23-25-19(29)12-3-2-4-13(9-12)26(30)31/h2-10H,1H3,(H,24,28)(H,25,29)(H2,20,21,22,23) |
| InChIKey | XXHHIRGAJSPMLJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|