C19H16BrN7O5 — CID 22535935
2-bromo-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535935) has the molecular formula C19H16BrN7O5 and a molecular weight of 502.29 g/mol. Its IUPAC name is 2-bromo-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-bromo-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535935 |
| Molecular Formula | C19H16BrN7O5 |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 2-bromo-N'-[6-[2-(4-methoxybenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc(NNC(=O)c3ccccc3Br)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H16BrN7O5/c1-32-12-8-6-11(7-9-12)18(28)25-23-16-15(27(30)31)17(22-10-21-16)24-26-19(29)13-4-2-3-5-14(13)20/h2-10H,1H3,(H,25,28)(H,26,29)(H2,21,22,23,24) |
| InChIKey | DGHDMGOHGZZALN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 160.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|