C13H13BrN6O3 — CID 23487180
2-bromo-N'-[6-(ethylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23487180) has the molecular formula C13H13BrN6O3 and a molecular weight of 381.19 g/mol. Its IUPAC name is 2-bromo-N'-[6-(ethylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-bromo-N'-[6-(ethylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23487180 |
| Molecular Formula | C13H13BrN6O3 |
| Molecular Weight | 381.19 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-bromo-N'-[6-(ethylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | CCNc1ncnc(NNC(=O)c2ccccc2Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13BrN6O3/c1-2-15-11-10(20(22)23)12(17-7-16-11)18-19-13(21)8-5-3-4-6-9(8)14/h3-7H,2H2,1H3,(H,19,21)(H2,15,16,17,18) |
| InChIKey | JHPZPINMIAGHBX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.19 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|