C15H18FN7O3 — CID 22535789
N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide (PubChem CID 22535789) has the molecular formula C15H18FN7O3 and a molecular weight of 363.35 g/mol. Its IUPAC name is N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide.
| Compound Name | N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
|---|---|
| PubChem CID | 22535789 |
| Molecular Formula | C15H18FN7O3 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-2-fluorobenzohydrazide |
| SMILES | CC(C)(C)NNc1ncnc(NNC(=O)c2ccccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18FN7O3/c1-15(2,3)22-20-13-11(23(25)26)12(17-8-18-13)19-21-14(24)9-6-4-5-7-10(9)16/h4-8,22H,1-3H3,(H,21,24)(H2,17,18,19,20) |
| InChIKey | ZGWIKNXPUGTWTK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|