C22H16FN7O4 — CID 22535771
N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide (PubChem CID 22535771) has the molecular formula C22H16FN7O4 and a molecular weight of 461.41 g/mol. Its IUPAC name is N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 22535771 |
| Molecular Formula | C22H16FN7O4 |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)c2cccc3ccccc23)c1[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C22H16FN7O4/c23-17-11-4-3-9-16(17)22(32)29-27-20-18(30(33)34)19(24-12-25-20)26-28-21(31)15-10-5-7-13-6-1-2-8-14(13)15/h1-12H,(H,28,31)(H,29,32)(H2,24,25,26,27) |
| InChIKey | OWDIGTSRVXUOQF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|