C20H17FN6O5 — CID 22535827
ethyl 2-[[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22535827) has the molecular formula C20H17FN6O5 and a molecular weight of 440.39 g/mol. Its IUPAC name is ethyl 2-[[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22535827 |
| Molecular Formula | C20H17FN6O5 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | ethyl 2-[[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NNC(=O)c2ccccc2F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17FN6O5/c1-2-32-20(29)13-8-4-6-10-15(13)24-17-16(27(30)31)18(23-11-22-17)25-26-19(28)12-7-3-5-9-14(12)21/h3-11H,2H2,1H3,(H,26,28)(H2,22,23,24,25) |
| InChIKey | MVSKZABZCFWXQT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|