C21H15FN6O3 — CID 22527560
2-fluoro-N'-[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22527560) has the molecular formula C21H15FN6O3 and a molecular weight of 418.39 g/mol. Its IUPAC name is 2-fluoro-N'-[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-fluoro-N'-[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22527560 |
| Molecular Formula | C21H15FN6O3 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-fluoro-N'-[6-(naphthalen-1-ylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cccc3ccccc23)c1[N+](=O)[O-])c1ccccc1F |
| InChI | InChI=1S/C21H15FN6O3/c22-16-10-4-3-9-15(16)21(29)27-26-20-18(28(30)31)19(23-12-24-20)25-17-11-5-7-13-6-1-2-8-14(13)17/h1-12H,(H,27,29)(H2,23,24,25,26) |
| InChIKey | VKWWBWXDNUSEIF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|