C22H18N6O3 — CID 22532865
N'-[6-(4-methylanilino)-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide (PubChem CID 22532865) has the molecular formula C22H18N6O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is N'-[6-(4-methylanilino)-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide.
| Compound Name | N'-[6-(4-methylanilino)-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
|---|---|
| PubChem CID | 22532865 |
| Molecular Formula | C22H18N6O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N'-[6-(4-methylanilino)-5-nitropyrimidin-4-yl]naphthalene-1-carbohydrazide |
| SMILES | Cc1ccc(Nc2ncnc(NNC(=O)c3cccc4ccccc34)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N6O3/c1-14-9-11-16(12-10-14)25-20-19(28(30)31)21(24-13-23-20)26-27-22(29)18-8-4-6-15-5-2-3-7-17(15)18/h2-13H,1H3,(H,27,29)(H2,23,24,25,26) |
| InChIKey | OEBLTRQOBJNRFY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|