C17H13FN8O4 — CID 22535775
N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22535775) has the molecular formula C17H13FN8O4 and a molecular weight of 412.34 g/mol. Its IUPAC name is N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22535775 |
| Molecular Formula | C17H13FN8O4 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | N'-[6-[2-(2-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)c2ccccc2F)c1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C17H13FN8O4/c18-12-6-2-1-5-11(12)17(28)25-23-15-13(26(29)30)14(20-9-21-15)22-24-16(27)10-4-3-7-19-8-10/h1-9H,(H,24,27)(H,25,28)(H2,20,21,22,23) |
| InChIKey | OYVZMVXNIRROAS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 164.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|