C17H12ClN9O6 — CID 22536247
N'-[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide (PubChem CID 22536247) has the molecular formula C17H12ClN9O6 and a molecular weight of 473.79 g/mol. Its IUPAC name is N'-[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide.
| Compound Name | N'-[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 22536247 |
| Molecular Formula | C17H12ClN9O6 |
| Molecular Weight | 473.79 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | N'-[6-[2-(4-chloro-3-nitrobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]pyridine-3-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)c2ccc(Cl)c([N+](=O)[O-])c2)c1[N+](=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C17H12ClN9O6/c18-11-4-3-9(6-12(11)26(30)31)16(28)24-22-14-13(27(32)33)15(21-8-20-14)23-25-17(29)10-2-1-5-19-7-10/h1-8H,(H,24,28)(H,25,29)(H2,20,21,22,23) |
| InChIKey | RJQBFEWDTFHKAJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.79 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|