C19H16ClN7O5 — CID 23484906
4-chloro-N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 23484906) has the molecular formula C19H16ClN7O5 and a molecular weight of 457.83 g/mol. Its IUPAC name is 4-chloro-N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | 4-chloro-N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 23484906 |
| Molecular Formula | C19H16ClN7O5 |
| Molecular Weight | 457.83 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-chloro-N'-[6-(3,4-dimethylanilino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | Cc1ccc(Nc2ncnc(NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H16ClN7O5/c1-10-3-5-13(7-11(10)2)23-17-16(27(31)32)18(22-9-21-17)24-25-19(28)12-4-6-14(20)15(8-12)26(29)30/h3-9H,1-2H3,(H,25,28)(H2,21,22,23,24) |
| InChIKey | IZROVZZBLZSGRR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|