C16H13ClN8O5S — CID 22533936
4-chloro-N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22533936) has the molecular formula C16H13ClN8O5S and a molecular weight of 464.85 g/mol. Its IUPAC name is 4-chloro-N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | 4-chloro-N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22533936 |
| Molecular Formula | C16H13ClN8O5S |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 4-chloro-N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | Cc1nc(Nc2ncnc(NNC(=O)c3ccc(Cl)c([N+](=O)[O-])c3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C16H13ClN8O5S/c1-7-8(2)31-16(20-7)21-13-12(25(29)30)14(19-6-18-13)22-23-15(26)9-3-4-10(17)11(5-9)24(27)28/h3-6H,1-2H3,(H,23,26)(H2,18,19,20,21,22) |
| InChIKey | SHWUTOSAQPEXJN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|