C18H12ClN7O3S — CID 22528545
N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 22528545) has the molecular formula C18H12ClN7O3S and a molecular weight of 441.86 g/mol. Its IUPAC name is N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 22528545 |
| Molecular Formula | C18H12ClN7O3S |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N'-[6-(1,3-benzothiazol-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2nc3ccccc3s2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12ClN7O3S/c19-11-5-3-4-10(8-11)17(27)25-24-16-14(26(28)29)15(20-9-21-16)23-18-22-12-6-1-2-7-13(12)30-18/h1-9H,(H,25,27)(H2,20,21,22,23,24) |
| InChIKey | XTSLHHKPBSRXBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|