C18H13BrClN7O4 — CID 22535440
N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 22535440) has the molecular formula C18H13BrClN7O4 and a molecular weight of 506.70 g/mol. Its IUPAC name is N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 22535440 |
| Molecular Formula | C18H13BrClN7O4 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)c2cccc(Cl)c2)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H13BrClN7O4/c19-12-6-4-10(5-7-12)17(28)25-23-15-14(27(30)31)16(22-9-21-15)24-26-18(29)11-2-1-3-13(20)8-11/h1-9H,(H,25,28)(H,26,29)(H2,21,22,23,24) |
| InChIKey | BWWZPBJRJGGBAY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 151.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|