C15H17ClN6O3 — CID 22536219
N'-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide (PubChem CID 22536219) has the molecular formula C15H17ClN6O3 and a molecular weight of 364.79 g/mol. Its IUPAC name is N'-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide.
| Compound Name | N'-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 22536219 |
| Molecular Formula | C15H17ClN6O3 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N'-[6-(butan-2-ylamino)-5-nitropyrimidin-4-yl]-3-chlorobenzohydrazide |
| SMILES | CCC(C)Nc1ncnc(NNC(=O)c2cccc(Cl)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17ClN6O3/c1-3-9(2)19-13-12(22(24)25)14(18-8-17-13)20-21-15(23)10-5-4-6-11(16)7-10/h4-9H,3H2,1-2H3,(H,21,23)(H2,17,18,19,20) |
| InChIKey | NQKATIQBLFBBNX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|