C17H12ClN5O3S — CID 22534036
3-chloro-N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)benzohydrazide (PubChem CID 22534036) has the molecular formula C17H12ClN5O3S and a molecular weight of 401.84 g/mol. Its IUPAC name is 3-chloro-N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)benzohydrazide.
| Compound Name | 3-chloro-N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 22534036 |
| Molecular Formula | C17H12ClN5O3S |
| Molecular Weight | 401.84 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 3-chloro-N'-(5-nitro-6-phenylsulfanylpyrimidin-4-yl)benzohydrazide |
| SMILES | O=C(NNc1ncnc(Sc2ccccc2)c1[N+](=O)[O-])c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H12ClN5O3S/c18-12-6-4-5-11(9-12)16(24)22-21-15-14(23(25)26)17(20-10-19-15)27-13-7-2-1-3-8-13/h1-10H,(H,22,24)(H,19,20,21) |
| InChIKey | WMVISBIXOWMOBA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|