C17H12Cl2N6O3 — CID 22530803
N'-[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22530803) has the molecular formula C17H12Cl2N6O3 and a molecular weight of 419.23 g/mol. Its IUPAC name is N'-[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22530803 |
| Molecular Formula | C17H12Cl2N6O3 |
| Molecular Weight | 419.23 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | N'-[6-(2,5-dichloroanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cc(Cl)ccc2Cl)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H12Cl2N6O3/c18-11-6-7-12(19)13(8-11)22-15-14(25(27)28)16(21-9-20-15)23-24-17(26)10-4-2-1-3-5-10/h1-9H,(H,24,26)(H2,20,21,22,23) |
| InChIKey | RABJVSMJXFCLBZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.23 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|