C16H12ClN7O3 — CID 22535060
N'-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535060) has the molecular formula C16H12ClN7O3 and a molecular weight of 385.77 g/mol. Its IUPAC name is N'-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | N'-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535060 |
| Molecular Formula | C16H12ClN7O3 |
| Molecular Weight | 385.77 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N'-[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cccnc2Cl)c1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C16H12ClN7O3/c17-13-11(7-4-8-18-13)21-14-12(24(26)27)15(20-9-19-14)22-23-16(25)10-5-2-1-3-6-10/h1-9H,(H,23,25)(H2,19,20,21,22) |
| InChIKey | VRKJUMMMSNQSLL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|